About 1,8-diazaspiro[4.5]decane;dihydrochloride
1,8-diazaspiro[4.5]decane;dihydrochloride (PubChem CID 50999337) has the molecular formula C8H18Cl2N2
and a molecular weight of 213.15 g/mol. Its IUPAC name is 1,8-diazaspiro[4.5]decane;dihydrochloride.
Molecular Properties
| Compound Name | 1,8-diazaspiro[4.5]decane;dihydrochloride |
| PubChem CID | 50999337 |
| Molecular Formula | C8H18Cl2N2 |
| Molecular Weight | 213.15 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 1,8-diazaspiro[4.5]decane;dihydrochloride |
| SMILES | C1CNC2(C1)CCNCC2.Cl.Cl |
| InChI | InChI=1S/C8H16N2.2ClH/c1-2-8(10-5-1)3-6-9-7-4-8;;/h9-10H,1-7H2;2*1H |
| InChIKey | UPHOLJXKVDTBGG-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.15 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,8-diazaspiro[4.5]decane;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,8-diazaspiro[4.5]decane;dihydrochloride?
The IUPAC name of 1,8-diazaspiro[4.5]decane;dihydrochloride (CID 50999337) is 1,8-diazaspiro[4.5]decane;dihydrochloride.
What is the SMILES notation for 1,8-diazaspiro[4.5]decane;dihydrochloride?
The canonical SMILES for 1,8-diazaspiro[4.5]decane;dihydrochloride is C1CNC2(C1)CCNCC2.Cl.Cl.
What is the InChIKey of 1,8-diazaspiro[4.5]decane;dihydrochloride?
The InChIKey is UPHOLJXKVDTBGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2.2ClH/c1-2-8(10-5-1)3-6-9-7-4-8;;/h9-10H,1-7H2;2*1H.
What are the key properties of 1,8-diazaspiro[4.5]decane;dihydrochloride?
1,8-diazaspiro[4.5]decane;dihydrochloride has a molecular weight of 213.15 g/mol, XLogP of 1.34, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,8-diazaspiro[4.5]decane;dihydrochloride is sourced from PubChem (CID 50999337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).