C13H30N2 — CID 144717621
ethane;8-methyl-1,8-diazaspiro[4.5]decane (PubChem CID 144717621) has the molecular formula C13H30N2 and a molecular weight of 214.40 g/mol. Its IUPAC name is ethane;8-methyl-1,8-diazaspiro[4.5]decane.
| Compound Name | ethane;8-methyl-1,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 144717621 |
| Molecular Formula | C13H30N2 |
| Molecular Weight | 214.40 g/mol |
| Exact Mass | 214.24 |
| IUPAC Name | ethane;8-methyl-1,8-diazaspiro[4.5]decane |
| SMILES | CC.CC.CN1CCC2(CCCN2)CC1 |
| InChI | InChI=1S/C9H18N2.2C2H6/c1-11-7-4-9(5-8-11)3-2-6-10-9;2*1-2/h10H,2-8H2,1H3;2*1-2H3 |
| InChIKey | RRZZLHUJZLKSFY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |