C10H20N2 — CID 96850341
(5S)-10-methyl-1,10-diazaspiro[4.6]undecane (PubChem CID 96850341) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is (5S)-10-methyl-1,10-diazaspiro[4.6]undecane.
| Compound Name | (5S)-10-methyl-1,10-diazaspiro[4.6]undecane |
|---|---|
| PubChem CID | 96850341 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | (5S)-10-methyl-1,10-diazaspiro[4.6]undecane |
| SMILES | CN1CCCC[C@]2(CCCN2)C1 |
| InChI | InChI=1S/C10H20N2/c1-12-8-3-2-5-10(9-12)6-4-7-11-10/h11H,2-9H2,1H3/t10-/m0/s1 |
| InChIKey | HIWLSQFCZLBBHJ-JTQLQIEISA-N |
| XLogP | 1.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |