C11H24N2 — CID 166075508
ethane;9-methyl-1,9-diazaspiro[4.5]decane (PubChem CID 166075508) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is ethane;9-methyl-1,9-diazaspiro[4.5]decane.
| Compound Name | ethane;9-methyl-1,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 166075508 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | ethane;9-methyl-1,9-diazaspiro[4.5]decane |
| SMILES | CC.CN1CCCC2(CCCN2)C1 |
| InChI | InChI=1S/C9H18N2.C2H6/c1-11-7-3-5-9(8-11)4-2-6-10-9;1-2/h10H,2-8H2,1H3;1-2H3 |
| InChIKey | YJGAUAFZBPAHOX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |