About 8-methyl-1,8-diazaspiro[3.5]nonan-2-one
8-methyl-1,8-diazaspiro[3.5]nonan-2-one (PubChem CID 169184407) has the molecular formula C8H14N2O
and a molecular weight of 154.21 g/mol. Its IUPAC name is 8-methyl-1,8-diazaspiro[3.5]nonan-2-one.
Molecular Properties
| Compound Name | 8-methyl-1,8-diazaspiro[3.5]nonan-2-one |
| PubChem CID | 169184407 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 8-methyl-1,8-diazaspiro[3.5]nonan-2-one |
| SMILES | CN1CCCC2(CC(=O)N2)C1 |
| InChI | InChI=1S/C8H14N2O/c1-10-4-2-3-8(6-10)5-7(11)9-8/h2-6H2,1H3,(H,9,11) |
| InChIKey | LLULRZNJUHYTEE-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-methyl-1,8-diazaspiro[3.5]nonan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-1,8-diazaspiro[3.5]nonan-2-one?
The IUPAC name of 8-methyl-1,8-diazaspiro[3.5]nonan-2-one (CID 169184407) is 8-methyl-1,8-diazaspiro[3.5]nonan-2-one.
What is the SMILES notation for 8-methyl-1,8-diazaspiro[3.5]nonan-2-one?
The canonical SMILES for 8-methyl-1,8-diazaspiro[3.5]nonan-2-one is CN1CCCC2(CC(=O)N2)C1.
What is the InChIKey of 8-methyl-1,8-diazaspiro[3.5]nonan-2-one?
The InChIKey is LLULRZNJUHYTEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O/c1-10-4-2-3-8(6-10)5-7(11)9-8/h2-6H2,1H3,(H,9,11).
What are the key properties of 8-methyl-1,8-diazaspiro[3.5]nonan-2-one?
8-methyl-1,8-diazaspiro[3.5]nonan-2-one has a molecular weight of 154.21 g/mol, XLogP of -0.03, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-1,8-diazaspiro[3.5]nonan-2-one is sourced from PubChem (CID 169184407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).