C8H17N3O2 — CID 177033435
9-methyl-1,3,9-triazaspiro[4.5]decane-2,4-dione;molecular hydrogen (PubChem CID 177033435) has the molecular formula C8H17N3O2 and a molecular weight of 187.24 g/mol. Its IUPAC name is 9-methyl-1,3,9-triazaspiro[4.5]decane-2,4-dione;molecular hydrogen.
| Compound Name | 9-methyl-1,3,9-triazaspiro[4.5]decane-2,4-dione;molecular hydrogen |
|---|---|
| PubChem CID | 177033435 |
| Molecular Formula | C8H17N3O2 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.13 |
| IUPAC Name | 9-methyl-1,3,9-triazaspiro[4.5]decane-2,4-dione;molecular hydrogen |
| SMILES | CN1CCCC2(C1)NC(=O)NC2=O.[H][H].[H][H] |
| InChI | InChI=1S/C8H13N3O2.2H2/c1-11-4-2-3-8(5-11)6(12)9-7(13)10-8;;/h2-5H2,1H3,(H2,9,10,12,13);2*1H |
| InChIKey | BKWCFCFOBMVZRR-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|