C8H13N3O2 — CID 130597066
2-methyl-2,6,9-triazaspiro[4.5]decane-8,10-dione (PubChem CID 130597066) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is 2-methyl-2,6,9-triazaspiro[4.5]decane-8,10-dione.
| Compound Name | 2-methyl-2,6,9-triazaspiro[4.5]decane-8,10-dione |
|---|---|
| PubChem CID | 130597066 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 2-methyl-2,6,9-triazaspiro[4.5]decane-8,10-dione |
| SMILES | CN1CCC2(C1)NCC(=O)NC2=O |
| InChI | InChI=1S/C8H13N3O2/c1-11-3-2-8(5-11)7(13)10-6(12)4-9-8/h9H,2-5H2,1H3,(H,10,12,13) |
| InChIKey | RULJPBUXZTVLOY-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|