C8H12N2O2 — CID 164972887
7-methyl-1,7-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 164972887) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 7-methyl-1,7-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 7-methyl-1,7-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 164972887 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 7-methyl-1,7-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | CN1CCC2(C1)NC(=O)CC2=O |
| InChI | InChI=1S/C8H12N2O2/c1-10-3-2-8(5-10)6(11)4-7(12)9-8/h2-5H2,1H3,(H,9,12) |
| InChIKey | IMQYETKFHRTIBD-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|