C13H30N2 — CID 144510455
2,7-dimethyl-2,7-diazaspiro[4.4]nonane;ethane (PubChem CID 144510455) has the molecular formula C13H30N2 and a molecular weight of 214.40 g/mol. Its IUPAC name is 2,7-dimethyl-2,7-diazaspiro[4.4]nonane;ethane.
| Compound Name | 2,7-dimethyl-2,7-diazaspiro[4.4]nonane;ethane |
|---|---|
| PubChem CID | 144510455 |
| Molecular Formula | C13H30N2 |
| Molecular Weight | 214.40 g/mol |
| Exact Mass | 214.24 |
| IUPAC Name | 2,7-dimethyl-2,7-diazaspiro[4.4]nonane;ethane |
| SMILES | CC.CC.CN1CCC2(CCN(C)C2)C1 |
| InChI | InChI=1S/C9H18N2.2C2H6/c1-10-5-3-9(7-10)4-6-11(2)8-9;2*1-2/h3-8H2,1-2H3;2*1-2H3 |
| InChIKey | PWVLADIBQKGSNP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |