C9H18N2 — CID 59304538
2-ethyl-7-methyl-2,7-diazaspiro[3.4]octane (PubChem CID 59304538) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is 2-ethyl-7-methyl-2,7-diazaspiro[3.4]octane.
| Compound Name | 2-ethyl-7-methyl-2,7-diazaspiro[3.4]octane |
|---|---|
| PubChem CID | 59304538 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 2-ethyl-7-methyl-2,7-diazaspiro[3.4]octane |
| SMILES | CCN1CC2(CCN(C)C2)C1 |
| InChI | InChI=1S/C9H18N2/c1-3-11-7-9(8-11)4-5-10(2)6-9/h3-8H2,1-2H3 |
| InChIKey | ZJKYIDBWYUOMHO-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |