C10H22N2 — CID 143122018
2,7-dimethyl-2,7-diazaspiro[3.4]octane;ethane (PubChem CID 143122018) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is 2,7-dimethyl-2,7-diazaspiro[3.4]octane;ethane.
| Compound Name | 2,7-dimethyl-2,7-diazaspiro[3.4]octane;ethane |
|---|---|
| PubChem CID | 143122018 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | 2,7-dimethyl-2,7-diazaspiro[3.4]octane;ethane |
| SMILES | CC.CN1CCC2(C1)CN(C)C2 |
| InChI | InChI=1S/C8H16N2.C2H6/c1-9-4-3-8(5-9)6-10(2)7-8;1-2/h3-7H2,1-2H3;1-2H3 |
| InChIKey | LFPDHRJWCUJBGW-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |