C18H42N2 — CID 177025738
ethane;2-methyl-8-propan-2-yl-2,8-diazaspiro[4.5]decane (PubChem CID 177025738) has the molecular formula C18H42N2 and a molecular weight of 286.55 g/mol. Its IUPAC name is ethane;2-methyl-8-propan-2-yl-2,8-diazaspiro[4.5]decane.
| Compound Name | ethane;2-methyl-8-propan-2-yl-2,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 177025738 |
| Molecular Formula | C18H42N2 |
| Molecular Weight | 286.55 g/mol |
| Exact Mass | 286.33 |
| IUPAC Name | ethane;2-methyl-8-propan-2-yl-2,8-diazaspiro[4.5]decane |
| SMILES | CC.CC.CC.CC(C)N1CCC2(CCN(C)C2)CC1 |
| InChI | InChI=1S/C12H24N2.3C2H6/c1-11(2)14-8-5-12(6-9-14)4-7-13(3)10-12;3*1-2/h11H,4-10H2,1-3H3;3*1-2H3 |
| InChIKey | RVGPPQWEMZQZHS-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.55 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |