C12H22N2O — CID 130731279
3-(7-methyl-2,7-diazaspiro[4.4]nonan-2-yl)butan-2-one (PubChem CID 130731279) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is 3-(7-methyl-2,7-diazaspiro[4.4]nonan-2-yl)butan-2-one.
| Compound Name | 3-(7-methyl-2,7-diazaspiro[4.4]nonan-2-yl)butan-2-one |
|---|---|
| PubChem CID | 130731279 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 3-(7-methyl-2,7-diazaspiro[4.4]nonan-2-yl)butan-2-one |
| SMILES | CC(=O)C(C)N1CCC2(CCN(C)C2)C1 |
| InChI | InChI=1S/C12H22N2O/c1-10(11(2)15)14-7-5-12(9-14)4-6-13(3)8-12/h10H,4-9H2,1-3H3 |
| InChIKey | OAEDKZHGEXAAAB-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |