C17H38N2 — CID 154672647
ethane;2-methyl-9-propan-2-yl-2,9-diazaspiro[5.5]undecane (PubChem CID 154672647) has the molecular formula C17H38N2 and a molecular weight of 270.50 g/mol. Its IUPAC name is ethane;2-methyl-9-propan-2-yl-2,9-diazaspiro[5.5]undecane.
| Compound Name | ethane;2-methyl-9-propan-2-yl-2,9-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 154672647 |
| Molecular Formula | C17H38N2 |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 270.30 |
| IUPAC Name | ethane;2-methyl-9-propan-2-yl-2,9-diazaspiro[5.5]undecane |
| SMILES | CC.CC.CC(C)N1CCC2(CCCN(C)C2)CC1 |
| InChI | InChI=1S/C13H26N2.2C2H6/c1-12(2)15-9-6-13(7-10-15)5-4-8-14(3)11-13;2*1-2/h12H,4-11H2,1-3H3;2*1-2H3 |
| InChIKey | XJMIPNNVHLOCRW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |