C10H23N3 — CID 169133295
ethane;8-methyl-2,8-diazaspiro[3.5]nonan-2-amine (PubChem CID 169133295) has the molecular formula C10H23N3 and a molecular weight of 185.31 g/mol. Its IUPAC name is ethane;8-methyl-2,8-diazaspiro[3.5]nonan-2-amine.
| Compound Name | ethane;8-methyl-2,8-diazaspiro[3.5]nonan-2-amine |
|---|---|
| PubChem CID | 169133295 |
| Molecular Formula | C10H23N3 |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.19 |
| IUPAC Name | ethane;8-methyl-2,8-diazaspiro[3.5]nonan-2-amine |
| SMILES | CC.CN1CCCC2(C1)CN(N)C2 |
| InChI | InChI=1S/C8H17N3.C2H6/c1-10-4-2-3-8(5-10)6-11(9)7-8;1-2/h2-7,9H2,1H3;1-2H3 |
| InChIKey | MCHFLLFWJOQBBW-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|