C12H26N2 — CID 177048791
ethane;2-ethyl-8-methyl-2,8-diazaspiro[3.5]nonane (PubChem CID 177048791) has the molecular formula C12H26N2 and a molecular weight of 198.35 g/mol. Its IUPAC name is ethane;2-ethyl-8-methyl-2,8-diazaspiro[3.5]nonane.
| Compound Name | ethane;2-ethyl-8-methyl-2,8-diazaspiro[3.5]nonane |
|---|---|
| PubChem CID | 177048791 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | ethane;2-ethyl-8-methyl-2,8-diazaspiro[3.5]nonane |
| SMILES | CC.CCN1CC2(CCCN(C)C2)C1 |
| InChI | InChI=1S/C10H20N2.C2H6/c1-3-12-8-10(9-12)5-4-6-11(2)7-10;1-2/h3-9H2,1-2H3;1-2H3 |
| InChIKey | UYZABIJVEUMHBQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |