About ethane;2-ethyl-7-pentyl-2,7-diazaspiro[3.5]nonane
ethane;2-ethyl-7-pentyl-2,7-diazaspiro[3.5]nonane (PubChem CID 171554465) has the molecular formula C18H40N2
and a molecular weight of 284.53 g/mol. Its IUPAC name is ethane;2-ethyl-7-pentyl-2,7-diazaspiro[3.5]nonane.
Molecular Properties
| Compound Name | ethane;2-ethyl-7-pentyl-2,7-diazaspiro[3.5]nonane |
| PubChem CID | 171554465 |
| Molecular Formula | C18H40N2 |
| Molecular Weight | 284.53 g/mol |
| Exact Mass | 284.32 |
| IUPAC Name | ethane;2-ethyl-7-pentyl-2,7-diazaspiro[3.5]nonane |
| SMILES | CC.CC.CCCCCN1CCC2(CC1)CN(CC)C2 |
| InChI | InChI=1S/C14H28N2.2C2H6/c1-3-5-6-9-16-10-7-14(8-11-16)12-15(4-2)13-14;2*1-2/h3-13H2,1-2H3;2*1-2H3 |
| InChIKey | GZBFKCMIIQPOEZ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.53 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-ethyl-7-pentyl-2,7-diazaspiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethyl-7-pentyl-2,7-diazaspiro[3.5]nonane?
The IUPAC name of ethane;2-ethyl-7-pentyl-2,7-diazaspiro[3.5]nonane (CID 171554465) is ethane;2-ethyl-7-pentyl-2,7-diazaspiro[3.5]nonane.
What is the SMILES notation for ethane;2-ethyl-7-pentyl-2,7-diazaspiro[3.5]nonane?
The canonical SMILES for ethane;2-ethyl-7-pentyl-2,7-diazaspiro[3.5]nonane is CC.CC.CCCCCN1CCC2(CC1)CN(CC)C2.
What is the InChIKey of ethane;2-ethyl-7-pentyl-2,7-diazaspiro[3.5]nonane?
The InChIKey is GZBFKCMIIQPOEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2.2C2H6/c1-3-5-6-9-16-10-7-14(8-11-16)12-15(4-2)13-14;2*1-2/h3-13H2,1-2H3;2*1-2H3.
What are the key properties of ethane;2-ethyl-7-pentyl-2,7-diazaspiro[3.5]nonane?
ethane;2-ethyl-7-pentyl-2,7-diazaspiro[3.5]nonane has a molecular weight of 284.53 g/mol, XLogP of 4.65, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethyl-7-pentyl-2,7-diazaspiro[3.5]nonane is sourced from PubChem (CID 171554465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).