C22H48N2 — CID 156829992
2,8-dipentyl-2,8-diazaspiro[4.5]decane;ethane (PubChem CID 156829992) has the molecular formula C22H48N2 and a molecular weight of 340.64 g/mol. Its IUPAC name is 2,8-dipentyl-2,8-diazaspiro[4.5]decane;ethane.
| Compound Name | 2,8-dipentyl-2,8-diazaspiro[4.5]decane;ethane |
|---|---|
| PubChem CID | 156829992 |
| Molecular Formula | C22H48N2 |
| Molecular Weight | 340.64 g/mol |
| Exact Mass | 340.38 |
| IUPAC Name | 2,8-dipentyl-2,8-diazaspiro[4.5]decane;ethane |
| SMILES | CC.CC.CCCCCN1CCC2(CC1)CCN(CCCCC)C2 |
| InChI | InChI=1S/C18H36N2.2C2H6/c1-3-5-7-12-19-14-9-18(10-15-19)11-16-20(17-18)13-8-6-4-2;2*1-2/h3-17H2,1-2H3;2*1-2H3 |
| InChIKey | DHYGODIEMKKMAP-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.64 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|