C13H26N2 — CID 129100662
9-ethyl-2-propyl-2,9-diazaspiro[4.5]decane (PubChem CID 129100662) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is 9-ethyl-2-propyl-2,9-diazaspiro[4.5]decane.
| Compound Name | 9-ethyl-2-propyl-2,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 129100662 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 9-ethyl-2-propyl-2,9-diazaspiro[4.5]decane |
| SMILES | CCCN1CCC2(CCCN(CC)C2)C1 |
| InChI | InChI=1S/C13H26N2/c1-3-8-15-10-7-13(12-15)6-5-9-14(4-2)11-13/h3-12H2,1-2H3 |
| InChIKey | RBDUGAIFMHLYCV-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |