C19H30N2 — CID 45236934
7-[(3-methylphenyl)methyl]-2-propyl-2,7-diazaspiro[4.5]decane (PubChem CID 45236934) has the molecular formula C19H30N2 and a molecular weight of 286.46 g/mol. Its IUPAC name is 7-[(3-methylphenyl)methyl]-2-propyl-2,7-diazaspiro[4.5]decane.
| Compound Name | 7-[(3-methylphenyl)methyl]-2-propyl-2,7-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 45236934 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | 7-[(3-methylphenyl)methyl]-2-propyl-2,7-diazaspiro[4.5]decane |
| SMILES | CCCN1CCC2(CCCN(Cc3cccc(C)c3)C2)C1 |
| InChI | InChI=1S/C19H30N2/c1-3-10-20-12-9-19(15-20)8-5-11-21(16-19)14-18-7-4-6-17(2)13-18/h4,6-7,13H,3,5,8-12,14-16H2,1-2H3 |
| InChIKey | ICSUAVLOVCDTPJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |