About ethane;1-ethyl-4-hexylpiperazine;methane
ethane;1-ethyl-4-hexylpiperazine;methane (PubChem CID 166111980) has the molecular formula C15H36N2
and a molecular weight of 244.47 g/mol. Its IUPAC name is ethane;1-ethyl-4-hexylpiperazine;methane.
Molecular Properties
| Compound Name | ethane;1-ethyl-4-hexylpiperazine;methane |
| PubChem CID | 166111980 |
| Molecular Formula | C15H36N2 |
| Molecular Weight | 244.47 g/mol |
| Exact Mass | 244.29 |
| IUPAC Name | ethane;1-ethyl-4-hexylpiperazine;methane |
| SMILES | C.CC.CCCCCCN1CCN(CC)CC1 |
| InChI | InChI=1S/C12H26N2.C2H6.CH4/c1-3-5-6-7-8-14-11-9-13(4-2)10-12-14;1-2;/h3-12H2,1-2H3;1-2H3;1H4 |
| InChIKey | QZGATUSLPCFTPS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-ethyl-4-hexylpiperazine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethyl-4-hexylpiperazine;methane?
The IUPAC name of ethane;1-ethyl-4-hexylpiperazine;methane (CID 166111980) is ethane;1-ethyl-4-hexylpiperazine;methane.
What is the SMILES notation for ethane;1-ethyl-4-hexylpiperazine;methane?
The canonical SMILES for ethane;1-ethyl-4-hexylpiperazine;methane is C.CC.CCCCCCN1CCN(CC)CC1.
What is the InChIKey of ethane;1-ethyl-4-hexylpiperazine;methane?
The InChIKey is QZGATUSLPCFTPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2.C2H6.CH4/c1-3-5-6-7-8-14-11-9-13(4-2)10-12-14;1-2;/h3-12H2,1-2H3;1-2H3;1H4.
What are the key properties of ethane;1-ethyl-4-hexylpiperazine;methane?
ethane;1-ethyl-4-hexylpiperazine;methane has a molecular weight of 244.47 g/mol, XLogP of 3.87, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethyl-4-hexylpiperazine;methane is sourced from PubChem (CID 166111980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).