About 1-hexyl-4-iodopiperazine
1-hexyl-4-iodopiperazine (PubChem CID 167297549) has the molecular formula C10H21IN2
and a molecular weight of 296.20 g/mol. Its IUPAC name is 1-hexyl-4-iodopiperazine.
Molecular Properties
| Compound Name | 1-hexyl-4-iodopiperazine |
| PubChem CID | 167297549 |
| Molecular Formula | C10H21IN2 |
| Molecular Weight | 296.20 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 1-hexyl-4-iodopiperazine |
| SMILES | CCCCCCN1CCN(I)CC1 |
| InChI | InChI=1S/C10H21IN2/c1-2-3-4-5-6-12-7-9-13(11)10-8-12/h2-10H2,1H3 |
| InChIKey | GAJVJUTXAXZYMM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.20 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-hexyl-4-iodopiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hexyl-4-iodopiperazine?
The IUPAC name of 1-hexyl-4-iodopiperazine (CID 167297549) is 1-hexyl-4-iodopiperazine.
What is the SMILES notation for 1-hexyl-4-iodopiperazine?
The canonical SMILES for 1-hexyl-4-iodopiperazine is CCCCCCN1CCN(I)CC1.
What is the InChIKey of 1-hexyl-4-iodopiperazine?
The InChIKey is GAJVJUTXAXZYMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21IN2/c1-2-3-4-5-6-12-7-9-13(11)10-8-12/h2-10H2,1H3.
What are the key properties of 1-hexyl-4-iodopiperazine?
1-hexyl-4-iodopiperazine has a molecular weight of 296.20 g/mol, XLogP of 2.53, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexyl-4-iodopiperazine is sourced from PubChem (CID 167297549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).