C13H28N2 — CID 156798626
ethane;2-ethyl-7-propan-2-yl-2,7-diazaspiro[3.4]octane (PubChem CID 156798626) has the molecular formula C13H28N2 and a molecular weight of 212.38 g/mol. Its IUPAC name is ethane;2-ethyl-7-propan-2-yl-2,7-diazaspiro[3.4]octane.
| Compound Name | ethane;2-ethyl-7-propan-2-yl-2,7-diazaspiro[3.4]octane |
|---|---|
| PubChem CID | 156798626 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | ethane;2-ethyl-7-propan-2-yl-2,7-diazaspiro[3.4]octane |
| SMILES | CC.CCN1CC2(CCN(C(C)C)C2)C1 |
| InChI | InChI=1S/C11H22N2.C2H6/c1-4-12-7-11(8-12)5-6-13(9-11)10(2)3;1-2/h10H,4-9H2,1-3H3;1-2H3 |
| InChIKey | KPOGWLHRLDVJIA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |