About ethane;7-ethyl-2-propan-2-yl-2,7-diazaspiro[4.4]nonane
ethane;7-ethyl-2-propan-2-yl-2,7-diazaspiro[4.4]nonane (PubChem CID 164540860) has the molecular formula C14H30N2
and a molecular weight of 226.41 g/mol. Its IUPAC name is ethane;7-ethyl-2-propan-2-yl-2,7-diazaspiro[4.4]nonane.
Molecular Properties
| Compound Name | ethane;7-ethyl-2-propan-2-yl-2,7-diazaspiro[4.4]nonane |
| PubChem CID | 164540860 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | ethane;7-ethyl-2-propan-2-yl-2,7-diazaspiro[4.4]nonane |
| SMILES | CC.CCN1CCC2(CCN(C(C)C)C2)C1 |
| InChI | InChI=1S/C12H24N2.C2H6/c1-4-13-7-5-12(9-13)6-8-14(10-12)11(2)3;1-2/h11H,4-10H2,1-3H3;1-2H3 |
| InChIKey | CPBKYJLWLZVFJW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;7-ethyl-2-propan-2-yl-2,7-diazaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;7-ethyl-2-propan-2-yl-2,7-diazaspiro[4.4]nonane?
The IUPAC name of ethane;7-ethyl-2-propan-2-yl-2,7-diazaspiro[4.4]nonane (CID 164540860) is ethane;7-ethyl-2-propan-2-yl-2,7-diazaspiro[4.4]nonane.
What is the SMILES notation for ethane;7-ethyl-2-propan-2-yl-2,7-diazaspiro[4.4]nonane?
The canonical SMILES for ethane;7-ethyl-2-propan-2-yl-2,7-diazaspiro[4.4]nonane is CC.CCN1CCC2(CCN(C(C)C)C2)C1.
What is the InChIKey of ethane;7-ethyl-2-propan-2-yl-2,7-diazaspiro[4.4]nonane?
The InChIKey is CPBKYJLWLZVFJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2.C2H6/c1-4-13-7-5-12(9-13)6-8-14(10-12)11(2)3;1-2/h11H,4-10H2,1-3H3;1-2H3.
What are the key properties of ethane;7-ethyl-2-propan-2-yl-2,7-diazaspiro[4.4]nonane?
ethane;7-ethyl-2-propan-2-yl-2,7-diazaspiro[4.4]nonane has a molecular weight of 226.41 g/mol, XLogP of 2.84, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;7-ethyl-2-propan-2-yl-2,7-diazaspiro[4.4]nonane is sourced from PubChem (CID 164540860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).