C14H28N2 — CID 170952212
2-butan-2-yl-7-propan-2-yl-2,7-diazaspiro[3.5]nonane (PubChem CID 170952212) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is 2-butan-2-yl-7-propan-2-yl-2,7-diazaspiro[3.5]nonane.
| Compound Name | 2-butan-2-yl-7-propan-2-yl-2,7-diazaspiro[3.5]nonane |
|---|---|
| PubChem CID | 170952212 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 2-butan-2-yl-7-propan-2-yl-2,7-diazaspiro[3.5]nonane |
| SMILES | CCC(C)N1CC2(CCN(C(C)C)CC2)C1 |
| InChI | InChI=1S/C14H28N2/c1-5-13(4)16-10-14(11-16)6-8-15(9-7-14)12(2)3/h12-13H,5-11H2,1-4H3 |
| InChIKey | NSZROIHFKPRIMI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |