C11H22IN2- — CID 176935087
2-methyliodanuidyl-7-propan-2-yl-2,7-diazaspiro[3.5]nonane (PubChem CID 176935087) has the molecular formula C11H22IN2- and a molecular weight of 309.21 g/mol. Its IUPAC name is 2-methyliodanuidyl-7-propan-2-yl-2,7-diazaspiro[3.5]nonane.
| Compound Name | 2-methyliodanuidyl-7-propan-2-yl-2,7-diazaspiro[3.5]nonane |
|---|---|
| PubChem CID | 176935087 |
| Molecular Formula | C11H22IN2- |
| Molecular Weight | 309.21 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 2-methyliodanuidyl-7-propan-2-yl-2,7-diazaspiro[3.5]nonane |
| SMILES | C[I-]N1CC2(CCN(C(C)C)CC2)C1 |
| InChI | InChI=1S/C11H22IN2/c1-10(2)13-6-4-11(5-7-13)8-14(9-11)12-3/h10H,4-9H2,1-3H3/q-1 |
| InChIKey | RNVHORCQFROANJ-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.21 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|