C18H33N — CID 176829653
2,3,8-tri(propan-2-yl)-8-azaspiro[4.5]dec-2-ene (PubChem CID 176829653) has the molecular formula C18H33N and a molecular weight of 263.47 g/mol. Its IUPAC name is 2,3,8-tri(propan-2-yl)-8-azaspiro[4.5]dec-2-ene.
| Compound Name | 2,3,8-tri(propan-2-yl)-8-azaspiro[4.5]dec-2-ene |
|---|---|
| PubChem CID | 176829653 |
| Molecular Formula | C18H33N |
| Molecular Weight | 263.47 g/mol |
| Exact Mass | 263.26 |
| IUPAC Name | 2,3,8-tri(propan-2-yl)-8-azaspiro[4.5]dec-2-ene |
| SMILES | CC(C)C1=C(C(C)C)CC2(CCN(C(C)C)CC2)C1 |
| InChI | InChI=1S/C18H33N/c1-13(2)16-11-18(12-17(16)14(3)4)7-9-19(10-8-18)15(5)6/h13-15H,7-12H2,1-6H3 |
| InChIKey | UGXLXGJMXSECOP-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.47 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|