C17H36N2 — CID 172605205
2,9-di(propan-2-yl)-2,9-diazaspiro[5.5]undecane;ethane (PubChem CID 172605205) has the molecular formula C17H36N2 and a molecular weight of 268.49 g/mol. Its IUPAC name is 2,9-di(propan-2-yl)-2,9-diazaspiro[5.5]undecane;ethane.
| Compound Name | 2,9-di(propan-2-yl)-2,9-diazaspiro[5.5]undecane;ethane |
|---|---|
| PubChem CID | 172605205 |
| Molecular Formula | C17H36N2 |
| Molecular Weight | 268.49 g/mol |
| Exact Mass | 268.29 |
| IUPAC Name | 2,9-di(propan-2-yl)-2,9-diazaspiro[5.5]undecane;ethane |
| SMILES | CC.CC(C)N1CCC2(CCCN(C(C)C)C2)CC1 |
| InChI | InChI=1S/C15H30N2.C2H6/c1-13(2)16-10-7-15(8-11-16)6-5-9-17(12-15)14(3)4;1-2/h13-14H,5-12H2,1-4H3;1-2H3 |
| InChIKey | CUHGVOSAASTROI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |