C12H23F2N — CID 170740276
2,2-difluoro-6-propan-2-yl-6-azaspiro[3.4]octane;ethane (PubChem CID 170740276) has the molecular formula C12H23F2N and a molecular weight of 219.32 g/mol. Its IUPAC name is 2,2-difluoro-6-propan-2-yl-6-azaspiro[3.4]octane;ethane.
| Compound Name | 2,2-difluoro-6-propan-2-yl-6-azaspiro[3.4]octane;ethane |
|---|---|
| PubChem CID | 170740276 |
| Molecular Formula | C12H23F2N |
| Molecular Weight | 219.32 g/mol |
| Exact Mass | 219.18 |
| IUPAC Name | 2,2-difluoro-6-propan-2-yl-6-azaspiro[3.4]octane;ethane |
| SMILES | CC.CC(C)N1CCC2(C1)CC(F)(F)C2 |
| InChI | InChI=1S/C10H17F2N.C2H6/c1-8(2)13-4-3-9(7-13)5-10(11,12)6-9;1-2/h8H,3-7H2,1-2H3;1-2H3 |
| InChIKey | VJIJBIAWXQTAKW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |