C12H24N2S — CID 130380883
1-(7-propan-2-yl-2,7-diazaspiro[4.4]nonan-2-yl)ethanethiol (PubChem CID 130380883) has the molecular formula C12H24N2S and a molecular weight of 228.40 g/mol. Its IUPAC name is 1-(7-propan-2-yl-2,7-diazaspiro[4.4]nonan-2-yl)ethanethiol.
| Compound Name | 1-(7-propan-2-yl-2,7-diazaspiro[4.4]nonan-2-yl)ethanethiol |
|---|---|
| PubChem CID | 130380883 |
| Molecular Formula | C12H24N2S |
| Molecular Weight | 228.40 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 1-(7-propan-2-yl-2,7-diazaspiro[4.4]nonan-2-yl)ethanethiol |
| SMILES | CC(C)N1CCC2(CCN(C(C)S)C2)C1 |
| InChI | InChI=1S/C12H24N2S/c1-10(2)13-6-4-12(8-13)5-7-14(9-12)11(3)15/h10-11,15H,4-9H2,1-3H3 |
| InChIKey | QJSRDVQUYKEKHO-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|