C11H21IN2 — CID 135200103
8-iodo-2-propan-2-yl-2,8-diazaspiro[4.5]decane (PubChem CID 135200103) has the molecular formula C11H21IN2 and a molecular weight of 308.21 g/mol. Its IUPAC name is 8-iodo-2-propan-2-yl-2,8-diazaspiro[4.5]decane.
| Compound Name | 8-iodo-2-propan-2-yl-2,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 135200103 |
| Molecular Formula | C11H21IN2 |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 8-iodo-2-propan-2-yl-2,8-diazaspiro[4.5]decane |
| SMILES | CC(C)N1CCC2(CCN(I)CC2)C1 |
| InChI | InChI=1S/C11H21IN2/c1-10(2)13-6-3-11(9-13)4-7-14(12)8-5-11/h10H,3-9H2,1-2H3 |
| InChIKey | SXNMPOIXMWVUMH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|