C10H20N2 — CID 58821247
2-propan-2-yl-2,7-diazaspiro[4.4]nonane (PubChem CID 58821247) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is 2-propan-2-yl-2,7-diazaspiro[4.4]nonane.
| Compound Name | 2-propan-2-yl-2,7-diazaspiro[4.4]nonane |
|---|---|
| PubChem CID | 58821247 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 2-propan-2-yl-2,7-diazaspiro[4.4]nonane |
| SMILES | CC(C)N1CCC2(CCNC2)C1 |
| InChI | InChI=1S/C10H20N2/c1-9(2)12-6-4-10(8-12)3-5-11-7-10/h9,11H,3-8H2,1-2H3 |
| InChIKey | ATGZUGOXTDMMAD-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |