C9H19N3 — CID 163884377
1-(2,7-diazaspiro[4.4]nonan-2-yl)ethanamine (PubChem CID 163884377) has the molecular formula C9H19N3 and a molecular weight of 169.27 g/mol. Its IUPAC name is 1-(2,7-diazaspiro[4.4]nonan-2-yl)ethanamine.
| Compound Name | 1-(2,7-diazaspiro[4.4]nonan-2-yl)ethanamine |
|---|---|
| PubChem CID | 163884377 |
| Molecular Formula | C9H19N3 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.16 |
| IUPAC Name | 1-(2,7-diazaspiro[4.4]nonan-2-yl)ethanamine |
| SMILES | CC(N)N1CCC2(CCNC2)C1 |
| InChI | InChI=1S/C9H19N3/c1-8(10)12-5-3-9(7-12)2-4-11-6-9/h8,11H,2-7,10H2,1H3 |
| InChIKey | PWBNSHNXYFPSMV-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |