2-ethyl-2,7-diazaspiro[4.4]nonane chloride

C9H18ClN2- — CID 53314750

IUPAC2-ethyl-2,7-diazaspiro[4.4]nonane chloride
SMILESCCN1CCC2(CCNC2)C1.[Cl-]
InChIInChI=1S/C9H18N2.ClH/c1-2-11-6-4-9(8-11)3-5-10-7-9;/h10H,2-8H2,1H3;1H/p-1
InChIKeyMSDSSFGZHCDAPS-UHFFFAOYSA-M
MW189.71 g/mol
LogP-2.30
Rot. Bonds1

About 2-ethyl-2,7-diazaspiro[4.4]nonane chloride

2-ethyl-2,7-diazaspiro[4.4]nonane chloride (PubChem CID 53314750) has the molecular formula C9H18ClN2- and a molecular weight of 189.71 g/mol. Its IUPAC name is 2-ethyl-2,7-diazaspiro[4.4]nonane chloride.

Molecular Properties

Compound Name2-ethyl-2,7-diazaspiro[4.4]nonane chloride
PubChem CID53314750
Molecular FormulaC9H18ClN2-
Molecular Weight189.71 g/mol
Exact Mass189.12
IUPAC Name2-ethyl-2,7-diazaspiro[4.4]nonane chloride
SMILESCCN1CCC2(CCNC2)C1.[Cl-]
InChIInChI=1S/C9H18N2.ClH/c1-2-11-6-4-9(8-11)3-5-10-7-9;/h10H,2-8H2,1H3;1H/p-1
InChIKeyMSDSSFGZHCDAPS-UHFFFAOYSA-M
XLogP-2.30
TPSA15.27 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500189.71
LogP ≤ 5-2.30
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-ethyl-2,7-diazaspiro[4.4]nonane chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethyl-2,7-diazaspiro[4.4]nonane chloride?
The IUPAC name of 2-ethyl-2,7-diazaspiro[4.4]nonane chloride (CID 53314750) is 2-ethyl-2,7-diazaspiro[4.4]nonane chloride.
What is the SMILES notation for 2-ethyl-2,7-diazaspiro[4.4]nonane chloride?
The canonical SMILES for 2-ethyl-2,7-diazaspiro[4.4]nonane chloride is CCN1CCC2(CCNC2)C1.[Cl-].
What is the InChIKey of 2-ethyl-2,7-diazaspiro[4.4]nonane chloride?
The InChIKey is MSDSSFGZHCDAPS-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H18N2.ClH/c1-2-11-6-4-9(8-11)3-5-10-7-9;/h10H,2-8H2,1H3;1H/p-1.
What are the key properties of 2-ethyl-2,7-diazaspiro[4.4]nonane chloride?
2-ethyl-2,7-diazaspiro[4.4]nonane chloride has a molecular weight of 189.71 g/mol, XLogP of -2.30, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2,7-diazaspiro[4.4]nonane chloride is sourced from PubChem (CID 53314750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).