C9H18ClN2- — CID 53314750
2-ethyl-2,7-diazaspiro[4.4]nonane chloride (PubChem CID 53314750) has the molecular formula C9H18ClN2- and a molecular weight of 189.71 g/mol. Its IUPAC name is 2-ethyl-2,7-diazaspiro[4.4]nonane chloride.
| Compound Name | 2-ethyl-2,7-diazaspiro[4.4]nonane chloride |
|---|---|
| PubChem CID | 53314750 |
| Molecular Formula | C9H18ClN2- |
| Molecular Weight | 189.71 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 2-ethyl-2,7-diazaspiro[4.4]nonane chloride |
| SMILES | CCN1CCC2(CCNC2)C1.[Cl-] |
| InChI | InChI=1S/C9H18N2.ClH/c1-2-11-6-4-9(8-11)3-5-10-7-9;/h10H,2-8H2,1H3;1H/p-1 |
| InChIKey | MSDSSFGZHCDAPS-UHFFFAOYSA-M |
| XLogP | -2.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.71 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |