About 2-[2-(2-methoxyethoxy)ethyl]-2,7-diazaspiro[4.4]nonane
2-[2-(2-methoxyethoxy)ethyl]-2,7-diazaspiro[4.4]nonane (PubChem CID 82038602) has the molecular formula C12H24N2O2
and a molecular weight of 228.34 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethyl]-2,7-diazaspiro[4.4]nonane.
Molecular Properties
| Compound Name | 2-[2-(2-methoxyethoxy)ethyl]-2,7-diazaspiro[4.4]nonane |
| PubChem CID | 82038602 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethyl]-2,7-diazaspiro[4.4]nonane |
| SMILES | COCCOCCN1CCC2(CCNC2)C1 |
| InChI | InChI=1S/C12H24N2O2/c1-15-8-9-16-7-6-14-5-3-12(11-14)2-4-13-10-12/h13H,2-11H2,1H3 |
| InChIKey | MFOHLLINMWKQEQ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2-methoxyethoxy)ethyl]-2,7-diazaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-methoxyethoxy)ethyl]-2,7-diazaspiro[4.4]nonane?
The IUPAC name of 2-[2-(2-methoxyethoxy)ethyl]-2,7-diazaspiro[4.4]nonane (CID 82038602) is 2-[2-(2-methoxyethoxy)ethyl]-2,7-diazaspiro[4.4]nonane.
What is the SMILES notation for 2-[2-(2-methoxyethoxy)ethyl]-2,7-diazaspiro[4.4]nonane?
The canonical SMILES for 2-[2-(2-methoxyethoxy)ethyl]-2,7-diazaspiro[4.4]nonane is COCCOCCN1CCC2(CCNC2)C1.
What is the InChIKey of 2-[2-(2-methoxyethoxy)ethyl]-2,7-diazaspiro[4.4]nonane?
The InChIKey is MFOHLLINMWKQEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O2/c1-15-8-9-16-7-6-14-5-3-12(11-14)2-4-13-10-12/h13H,2-11H2,1H3.
What are the key properties of 2-[2-(2-methoxyethoxy)ethyl]-2,7-diazaspiro[4.4]nonane?
2-[2-(2-methoxyethoxy)ethyl]-2,7-diazaspiro[4.4]nonane has a molecular weight of 228.34 g/mol, XLogP of 0.33, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-methoxyethoxy)ethyl]-2,7-diazaspiro[4.4]nonane is sourced from PubChem (CID 82038602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).