C12H24N2O2 — CID 82038602
2-[2-(2-methoxyethoxy)ethyl]-2,7-diazaspiro[4.4]nonane (PubChem CID 82038602) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethyl]-2,7-diazaspiro[4.4]nonane.
| Compound Name | 2-[2-(2-methoxyethoxy)ethyl]-2,7-diazaspiro[4.4]nonane |
|---|---|
| PubChem CID | 82038602 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethyl]-2,7-diazaspiro[4.4]nonane |
| SMILES | COCCOCCN1CCC2(CCNC2)C1 |
| InChI | InChI=1S/C12H24N2O2/c1-15-8-9-16-7-6-14-5-3-12(11-14)2-4-13-10-12/h13H,2-11H2,1H3 |
| InChIKey | MFOHLLINMWKQEQ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|