C10H20N2S — CID 130525850
2-(2-methylsulfanylethyl)-2,7-diazaspiro[4.4]nonane (PubChem CID 130525850) has the molecular formula C10H20N2S and a molecular weight of 200.35 g/mol. Its IUPAC name is 2-(2-methylsulfanylethyl)-2,7-diazaspiro[4.4]nonane.
| Compound Name | 2-(2-methylsulfanylethyl)-2,7-diazaspiro[4.4]nonane |
|---|---|
| PubChem CID | 130525850 |
| Molecular Formula | C10H20N2S |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 2-(2-methylsulfanylethyl)-2,7-diazaspiro[4.4]nonane |
| SMILES | CSCCN1CCC2(CCNC2)C1 |
| InChI | InChI=1S/C10H20N2S/c1-13-7-6-12-5-3-10(9-12)2-4-11-8-10/h11H,2-9H2,1H3 |
| InChIKey | XFJZLHJPVBSKTB-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |