C10H20N2 — CID 46318290
8-ethyl-2,8-diazaspiro[4.5]decane (PubChem CID 46318290) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is 8-ethyl-2,8-diazaspiro[4.5]decane.
| Compound Name | 8-ethyl-2,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 46318290 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 8-ethyl-2,8-diazaspiro[4.5]decane |
| SMILES | CCN1CCC2(CCNC2)CC1 |
| InChI | InChI=1S/C10H20N2/c1-2-12-7-4-10(5-8-12)3-6-11-9-10/h11H,2-9H2,1H3 |
| InChIKey | LBJYTUPXMFMNOK-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |