About 2,8-diazaspiro[4.5]decane;ethane
2,8-diazaspiro[4.5]decane;ethane (PubChem CID 143048064) has the molecular formula C10H22N2
and a molecular weight of 170.30 g/mol. Its IUPAC name is 2,8-diazaspiro[4.5]decane;ethane.
Molecular Properties
| Compound Name | 2,8-diazaspiro[4.5]decane;ethane |
| PubChem CID | 143048064 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | 2,8-diazaspiro[4.5]decane;ethane |
| SMILES | C1CC2(CCN1)CCNC2.CC |
| InChI | InChI=1S/C8H16N2.C2H6/c1-4-9-5-2-8(1)3-6-10-7-8;1-2/h9-10H,1-7H2;1-2H3 |
| InChIKey | BINZSLMWPMNJFQ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,8-diazaspiro[4.5]decane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,8-diazaspiro[4.5]decane;ethane?
The IUPAC name of 2,8-diazaspiro[4.5]decane;ethane (CID 143048064) is 2,8-diazaspiro[4.5]decane;ethane.
What is the SMILES notation for 2,8-diazaspiro[4.5]decane;ethane?
The canonical SMILES for 2,8-diazaspiro[4.5]decane;ethane is C1CC2(CCN1)CCNC2.CC.
What is the InChIKey of 2,8-diazaspiro[4.5]decane;ethane?
The InChIKey is BINZSLMWPMNJFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2.C2H6/c1-4-9-5-2-8(1)3-6-10-7-8;1-2/h9-10H,1-7H2;1-2H3.
What are the key properties of 2,8-diazaspiro[4.5]decane;ethane?
2,8-diazaspiro[4.5]decane;ethane has a molecular weight of 170.30 g/mol, XLogP of 1.38, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8-diazaspiro[4.5]decane;ethane is sourced from PubChem (CID 143048064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).