About potassium;2,8-diazaspiro[4.5]decan-8-ylmethanone;ethane
potassium;2,8-diazaspiro[4.5]decan-8-ylmethanone;ethane (PubChem CID 164876170) has the molecular formula C11H21KN2O
and a molecular weight of 236.40 g/mol. Its IUPAC name is potassium;2,8-diazaspiro[4.5]decan-8-ylmethanone;ethane.
Molecular Properties
| Compound Name | potassium;2,8-diazaspiro[4.5]decan-8-ylmethanone;ethane |
| PubChem CID | 164876170 |
| Molecular Formula | C11H21KN2O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | potassium;2,8-diazaspiro[4.5]decan-8-ylmethanone;ethane |
| SMILES | CC.O=[C-]N1CCC2(CCNC2)CC1.[K+] |
| InChI | InChI=1S/C9H15N2O.C2H6.K/c12-8-11-5-2-9(3-6-11)1-4-10-7-9;1-2;/h10H,1-7H2;1-2H3;/q-1;;+1 |
| InChIKey | RVMKYQWQUKDKAE-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze potassium;2,8-diazaspiro[4.5]decan-8-ylmethanone;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;2,8-diazaspiro[4.5]decan-8-ylmethanone;ethane?
The IUPAC name of potassium;2,8-diazaspiro[4.5]decan-8-ylmethanone;ethane (CID 164876170) is potassium;2,8-diazaspiro[4.5]decan-8-ylmethanone;ethane.
What is the SMILES notation for potassium;2,8-diazaspiro[4.5]decan-8-ylmethanone;ethane?
The canonical SMILES for potassium;2,8-diazaspiro[4.5]decan-8-ylmethanone;ethane is CC.O=[C-]N1CCC2(CCNC2)CC1.[K+].
What is the InChIKey of potassium;2,8-diazaspiro[4.5]decan-8-ylmethanone;ethane?
The InChIKey is RVMKYQWQUKDKAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N2O.C2H6.K/c12-8-11-5-2-9(3-6-11)1-4-10-7-9;1-2;/h10H,1-7H2;1-2H3;/q-1;;+1.
What are the key properties of potassium;2,8-diazaspiro[4.5]decan-8-ylmethanone;ethane?
potassium;2,8-diazaspiro[4.5]decan-8-ylmethanone;ethane has a molecular weight of 236.40 g/mol, XLogP of -1.84, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;2,8-diazaspiro[4.5]decan-8-ylmethanone;ethane is sourced from PubChem (CID 164876170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).