C8H18N2 — CID 143687523
2,7-diazaspiro[3.4]octane;ethane (PubChem CID 143687523) has the molecular formula C8H18N2 and a molecular weight of 142.25 g/mol. Its IUPAC name is 2,7-diazaspiro[3.4]octane;ethane.
| Compound Name | 2,7-diazaspiro[3.4]octane;ethane |
|---|---|
| PubChem CID | 143687523 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | 2,7-diazaspiro[3.4]octane;ethane |
| SMILES | C1CC2(CN1)CNC2.CC |
| InChI | InChI=1S/C6H12N2.C2H6/c1-2-7-3-6(1)4-8-5-6;1-2/h7-8H,1-5H2;1-2H3 |
| InChIKey | XAHCCWALOKLGDJ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |