About 2-azaspiro[4.5]decane;ethene
2-azaspiro[4.5]decane;ethene (PubChem CID 171834081) has the molecular formula C11H21N
and a molecular weight of 167.30 g/mol. Its IUPAC name is 2-azaspiro[4.5]decane;ethene.
Molecular Properties
| Compound Name | 2-azaspiro[4.5]decane;ethene |
| PubChem CID | 171834081 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | 2-azaspiro[4.5]decane;ethene |
| SMILES | C1CCC2(CC1)CCNC2.C=C |
| InChI | InChI=1S/C9H17N.C2H4/c1-2-4-9(5-3-1)6-7-10-8-9;1-2/h10H,1-8H2;1-2H2 |
| InChIKey | RTJJDINEXDQRGE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-azaspiro[4.5]decane;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azaspiro[4.5]decane;ethene?
The IUPAC name of 2-azaspiro[4.5]decane;ethene (CID 171834081) is 2-azaspiro[4.5]decane;ethene.
What is the SMILES notation for 2-azaspiro[4.5]decane;ethene?
The canonical SMILES for 2-azaspiro[4.5]decane;ethene is C1CCC2(CC1)CCNC2.C=C.
What is the InChIKey of 2-azaspiro[4.5]decane;ethene?
The InChIKey is RTJJDINEXDQRGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N.C2H4/c1-2-4-9(5-3-1)6-7-10-8-9;1-2/h10H,1-8H2;1-2H2.
What are the key properties of 2-azaspiro[4.5]decane;ethene?
2-azaspiro[4.5]decane;ethene has a molecular weight of 167.30 g/mol, XLogP of 2.73, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azaspiro[4.5]decane;ethene is sourced from PubChem (CID 171834081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).