About 2-azaspiro[4.5]decane;ethyl formate
2-azaspiro[4.5]decane;ethyl formate (PubChem CID 144702388) has the molecular formula C12H23NO2
and a molecular weight of 213.32 g/mol. Its IUPAC name is 2-azaspiro[4.5]decane;ethyl formate.
Molecular Properties
| Compound Name | 2-azaspiro[4.5]decane;ethyl formate |
| PubChem CID | 144702388 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 2-azaspiro[4.5]decane;ethyl formate |
| SMILES | C1CCC2(CC1)CCNC2.CCOC=O |
| InChI | InChI=1S/C9H17N.C3H6O2/c1-2-4-9(5-3-1)6-7-10-8-9;1-2-5-3-4/h10H,1-8H2;3H,2H2,1H3 |
| InChIKey | SPAOFFQGLRYLBX-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-azaspiro[4.5]decane;ethyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azaspiro[4.5]decane;ethyl formate?
The IUPAC name of 2-azaspiro[4.5]decane;ethyl formate (CID 144702388) is 2-azaspiro[4.5]decane;ethyl formate.
What is the SMILES notation for 2-azaspiro[4.5]decane;ethyl formate?
The canonical SMILES for 2-azaspiro[4.5]decane;ethyl formate is C1CCC2(CC1)CCNC2.CCOC=O.
What is the InChIKey of 2-azaspiro[4.5]decane;ethyl formate?
The InChIKey is SPAOFFQGLRYLBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N.C3H6O2/c1-2-4-9(5-3-1)6-7-10-8-9;1-2-5-3-4/h10H,1-8H2;3H,2H2,1H3.
What are the key properties of 2-azaspiro[4.5]decane;ethyl formate?
2-azaspiro[4.5]decane;ethyl formate has a molecular weight of 213.32 g/mol, XLogP of 2.11, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azaspiro[4.5]decane;ethyl formate is sourced from PubChem (CID 144702388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).