About 3-azaspiro[5.5]undecane;ethane;propane
3-azaspiro[5.5]undecane;ethane;propane (PubChem CID 177188423) has the molecular formula C15H33N
and a molecular weight of 227.44 g/mol. Its IUPAC name is 3-azaspiro[5.5]undecane;ethane;propane.
Molecular Properties
| Compound Name | 3-azaspiro[5.5]undecane;ethane;propane |
| PubChem CID | 177188423 |
| Molecular Formula | C15H33N |
| Molecular Weight | 227.44 g/mol |
| Exact Mass | 227.26 |
| IUPAC Name | 3-azaspiro[5.5]undecane;ethane;propane |
| SMILES | C1CCC2(CC1)CCNCC2.CC.CCC |
| InChI | InChI=1S/C10H19N.C3H8.C2H6/c1-2-4-10(5-3-1)6-8-11-9-7-10;1-3-2;1-2/h11H,1-9H2;3H2,1-2H3;1-2H3 |
| InChIKey | YDIIHDYNEAHRAA-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-azaspiro[5.5]undecane;ethane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-azaspiro[5.5]undecane;ethane;propane?
The IUPAC name of 3-azaspiro[5.5]undecane;ethane;propane (CID 177188423) is 3-azaspiro[5.5]undecane;ethane;propane.
What is the SMILES notation for 3-azaspiro[5.5]undecane;ethane;propane?
The canonical SMILES for 3-azaspiro[5.5]undecane;ethane;propane is C1CCC2(CC1)CCNCC2.CC.CCC.
What is the InChIKey of 3-azaspiro[5.5]undecane;ethane;propane?
The InChIKey is YDIIHDYNEAHRAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N.C3H8.C2H6/c1-2-4-10(5-3-1)6-8-11-9-7-10;1-3-2;1-2/h11H,1-9H2;3H2,1-2H3;1-2H3.
What are the key properties of 3-azaspiro[5.5]undecane;ethane;propane?
3-azaspiro[5.5]undecane;ethane;propane has a molecular weight of 227.44 g/mol, XLogP of 4.76, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-azaspiro[5.5]undecane;ethane;propane is sourced from PubChem (CID 177188423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).