About 6-azaspiro[2.5]octane;ethane;propane
6-azaspiro[2.5]octane;ethane;propane (PubChem CID 176979994) has the molecular formula C12H27N
and a molecular weight of 185.35 g/mol. Its IUPAC name is 6-azaspiro[2.5]octane;ethane;propane.
Molecular Properties
| Compound Name | 6-azaspiro[2.5]octane;ethane;propane |
| PubChem CID | 176979994 |
| Molecular Formula | C12H27N |
| Molecular Weight | 185.35 g/mol |
| Exact Mass | 185.21 |
| IUPAC Name | 6-azaspiro[2.5]octane;ethane;propane |
| SMILES | C1CC2(CCN1)CC2.CC.CCC |
| InChI | InChI=1S/C7H13N.C3H8.C2H6/c1-2-7(1)3-5-8-6-4-7;1-3-2;1-2/h8H,1-6H2;3H2,1-2H3;1-2H3 |
| InChIKey | MEODYTMDQAMKSM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-azaspiro[2.5]octane;ethane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-azaspiro[2.5]octane;ethane;propane?
The IUPAC name of 6-azaspiro[2.5]octane;ethane;propane (CID 176979994) is 6-azaspiro[2.5]octane;ethane;propane.
What is the SMILES notation for 6-azaspiro[2.5]octane;ethane;propane?
The canonical SMILES for 6-azaspiro[2.5]octane;ethane;propane is C1CC2(CCN1)CC2.CC.CCC.
What is the InChIKey of 6-azaspiro[2.5]octane;ethane;propane?
The InChIKey is MEODYTMDQAMKSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N.C3H8.C2H6/c1-2-7(1)3-5-8-6-4-7;1-3-2;1-2/h8H,1-6H2;3H2,1-2H3;1-2H3.
What are the key properties of 6-azaspiro[2.5]octane;ethane;propane?
6-azaspiro[2.5]octane;ethane;propane has a molecular weight of 185.35 g/mol, XLogP of 3.59, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-azaspiro[2.5]octane;ethane;propane is sourced from PubChem (CID 176979994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).