C10H22N2 — CID 143448801
ethane;2-methyl-2,7-diazaspiro[3.5]nonane (PubChem CID 143448801) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is ethane;2-methyl-2,7-diazaspiro[3.5]nonane.
| Compound Name | ethane;2-methyl-2,7-diazaspiro[3.5]nonane |
|---|---|
| PubChem CID | 143448801 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | ethane;2-methyl-2,7-diazaspiro[3.5]nonane |
| SMILES | CC.CN1CC2(CCNCC2)C1 |
| InChI | InChI=1S/C8H16N2.C2H6/c1-10-6-8(7-10)2-4-9-5-3-8;1-2/h9H,2-7H2,1H3;1-2H3 |
| InChIKey | WGSWKKAXROFDDQ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |