C8H16N2 — CID 55298774
1-methyl-1,7-diazaspiro[3.5]nonane (PubChem CID 55298774) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is 1-methyl-1,7-diazaspiro[3.5]nonane.
| Compound Name | 1-methyl-1,7-diazaspiro[3.5]nonane |
|---|---|
| PubChem CID | 55298774 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 1-methyl-1,7-diazaspiro[3.5]nonane |
| SMILES | CN1CCC12CCNCC2 |
| InChI | InChI=1S/C8H16N2/c1-10-7-4-8(10)2-5-9-6-3-8/h9H,2-7H2,1H3 |
| InChIKey | LOCFMACIKGSCOQ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |