C8H20Cl2N2 — CID 57481577
N,N,4-trimethylpiperidin-4-amine;dihydrochloride (PubChem CID 57481577) has the molecular formula C8H20Cl2N2 and a molecular weight of 215.17 g/mol. Its IUPAC name is N,N,4-trimethylpiperidin-4-amine;dihydrochloride.
| Compound Name | N,N,4-trimethylpiperidin-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 57481577 |
| Molecular Formula | C8H20Cl2N2 |
| Molecular Weight | 215.17 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | N,N,4-trimethylpiperidin-4-amine;dihydrochloride |
| SMILES | CN(C)C1(C)CCNCC1.Cl.Cl |
| InChI | InChI=1S/C8H18N2.2ClH/c1-8(10(2)3)4-6-9-7-5-8;;/h9H,4-7H2,1-3H3;2*1H |
| InChIKey | JZSJTJSIHKPWTA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.17 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |