About N,N,4-trimethylpiperidin-4-amine;dihydrochloride
N,N,4-trimethylpiperidin-4-amine;dihydrochloride (PubChem CID 57481577) has the molecular formula C8H20Cl2N2
and a molecular weight of 215.17 g/mol. Its IUPAC name is N,N,4-trimethylpiperidin-4-amine;dihydrochloride.
Molecular Properties
| Compound Name | N,N,4-trimethylpiperidin-4-amine;dihydrochloride |
| PubChem CID | 57481577 |
| Molecular Formula | C8H20Cl2N2 |
| Molecular Weight | 215.17 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | N,N,4-trimethylpiperidin-4-amine;dihydrochloride |
| SMILES | CN(C)C1(C)CCNCC1.Cl.Cl |
| InChI | InChI=1S/C8H18N2.2ClH/c1-8(10(2)3)4-6-9-7-5-8;;/h9H,4-7H2,1-3H3;2*1H |
| InChIKey | JZSJTJSIHKPWTA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.17 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N,4-trimethylpiperidin-4-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N,4-trimethylpiperidin-4-amine;dihydrochloride?
The IUPAC name of N,N,4-trimethylpiperidin-4-amine;dihydrochloride (CID 57481577) is N,N,4-trimethylpiperidin-4-amine;dihydrochloride.
What is the SMILES notation for N,N,4-trimethylpiperidin-4-amine;dihydrochloride?
The canonical SMILES for N,N,4-trimethylpiperidin-4-amine;dihydrochloride is CN(C)C1(C)CCNCC1.Cl.Cl.
What is the InChIKey of N,N,4-trimethylpiperidin-4-amine;dihydrochloride?
The InChIKey is JZSJTJSIHKPWTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2.2ClH/c1-8(10(2)3)4-6-9-7-5-8;;/h9H,4-7H2,1-3H3;2*1H.
What are the key properties of N,N,4-trimethylpiperidin-4-amine;dihydrochloride?
N,N,4-trimethylpiperidin-4-amine;dihydrochloride has a molecular weight of 215.17 g/mol, XLogP of 1.53, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N,4-trimethylpiperidin-4-amine;dihydrochloride is sourced from PubChem (CID 57481577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).