About 2,9-diazaspiro[4.5]decane;methane
2,9-diazaspiro[4.5]decane;methane (PubChem CID 143578856) has the molecular formula C9H20N2
and a molecular weight of 156.27 g/mol. Its IUPAC name is 2,9-diazaspiro[4.5]decane;methane.
Molecular Properties
| Compound Name | 2,9-diazaspiro[4.5]decane;methane |
| PubChem CID | 143578856 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | 2,9-diazaspiro[4.5]decane;methane |
| SMILES | C.C1CNCC2(C1)CCNC2 |
| InChI | InChI=1S/C8H16N2.CH4/c1-2-8(6-9-4-1)3-5-10-7-8;/h9-10H,1-7H2;1H4 |
| InChIKey | DRVFURHNUKVLGR-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,9-diazaspiro[4.5]decane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,9-diazaspiro[4.5]decane;methane?
The IUPAC name of 2,9-diazaspiro[4.5]decane;methane (CID 143578856) is 2,9-diazaspiro[4.5]decane;methane.
What is the SMILES notation for 2,9-diazaspiro[4.5]decane;methane?
The canonical SMILES for 2,9-diazaspiro[4.5]decane;methane is C.C1CNCC2(C1)CCNC2.
What is the InChIKey of 2,9-diazaspiro[4.5]decane;methane?
The InChIKey is DRVFURHNUKVLGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2.CH4/c1-2-8(6-9-4-1)3-5-10-7-8;/h9-10H,1-7H2;1H4.
What are the key properties of 2,9-diazaspiro[4.5]decane;methane?
2,9-diazaspiro[4.5]decane;methane has a molecular weight of 156.27 g/mol, XLogP of 0.99, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,9-diazaspiro[4.5]decane;methane is sourced from PubChem (CID 143578856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).