C13H28N2O — CID 145006494
ethane;8-methyl-2,8-diazaspiro[4.5]decan-7-one (PubChem CID 145006494) has the molecular formula C13H28N2O and a molecular weight of 228.38 g/mol. Its IUPAC name is ethane;8-methyl-2,8-diazaspiro[4.5]decan-7-one.
| Compound Name | ethane;8-methyl-2,8-diazaspiro[4.5]decan-7-one |
|---|---|
| PubChem CID | 145006494 |
| Molecular Formula | C13H28N2O |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.22 |
| IUPAC Name | ethane;8-methyl-2,8-diazaspiro[4.5]decan-7-one |
| SMILES | CC.CC.CN1CCC2(CCNC2)CC1=O |
| InChI | InChI=1S/C9H16N2O.2C2H6/c1-11-5-3-9(6-8(11)12)2-4-10-7-9;2*1-2/h10H,2-7H2,1H3;2*1-2H3 |
| InChIKey | FSEMNOQQHXPDTG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |