C10H19NO3 — CID 144669099
ethane;8-methyl-1,4-dioxa-8-azaspiro[4.5]decan-7-one (PubChem CID 144669099) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is ethane;8-methyl-1,4-dioxa-8-azaspiro[4.5]decan-7-one.
| Compound Name | ethane;8-methyl-1,4-dioxa-8-azaspiro[4.5]decan-7-one |
|---|---|
| PubChem CID | 144669099 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | ethane;8-methyl-1,4-dioxa-8-azaspiro[4.5]decan-7-one |
| SMILES | CC.CN1CCC2(CC1=O)OCCO2 |
| InChI | InChI=1S/C8H13NO3.C2H6/c1-9-3-2-8(6-7(9)10)11-4-5-12-8;1-2/h2-6H2,1H3;1-2H3 |
| InChIKey | TUDOFVAVDRGCOP-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |